C14H17ClFNO — CID 143641570
(6S)-6-(3-chloro-4-fluorophenyl)-1-(methoxymethyl)-3-azabicyclo[4.1.0]heptane (PubChem CID 143641570) has the molecular formula C14H17ClFNO and a molecular weight of 269.75 g/mol. Its IUPAC name is (6S)-6-(3-chloro-4-fluorophenyl)-1-(methoxymethyl)-3-azabicyclo[4.1.0]heptane.
| Compound Name | (6S)-6-(3-chloro-4-fluorophenyl)-1-(methoxymethyl)-3-azabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 143641570 |
| Molecular Formula | C14H17ClFNO |
| Molecular Weight | 269.75 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | (6S)-6-(3-chloro-4-fluorophenyl)-1-(methoxymethyl)-3-azabicyclo[4.1.0]heptane |
| SMILES | COCC12CNCC[C@]1(c1ccc(F)c(Cl)c1)C2 |
| InChI | InChI=1S/C14H17ClFNO/c1-18-9-13-7-14(13,4-5-17-8-13)10-2-3-12(16)11(15)6-10/h2-3,6,17H,4-5,7-9H2,1H3/t13?,14-/m1/s1 |
| InChIKey | SAIAWHLAJVOTCR-ARLHGKGLSA-N |
| XLogP | 2.75 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.75 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |