C11H20O — CID 143641869
3,5-diethyl-2-methylfuran;ethane (PubChem CID 143641869) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is 3,5-diethyl-2-methylfuran;ethane.
| Compound Name | 3,5-diethyl-2-methylfuran;ethane |
|---|---|
| PubChem CID | 143641869 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | 3,5-diethyl-2-methylfuran;ethane |
| SMILES | CC.CCc1cc(CC)c(C)o1 |
| InChI | InChI=1S/C9H14O.C2H6/c1-4-8-6-9(5-2)10-7(8)3;1-2/h6H,4-5H2,1-3H3;1-2H3 |
| InChIKey | WLQBZIFHXKNWMI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |