C20H29N5O3 — CID 143642047
(5E)-N-[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-3-(4-cyanobutyl)-2-oxo-5-[(2Z)-penta-2,4-dienylidene]imidazolidine-1-carboxamide (PubChem CID 143642047) has the molecular formula C20H29N5O3 and a molecular weight of 387.48 g/mol. Its IUPAC name is (5E)-N-[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-3-(4-cyanobutyl)-2-oxo-5-[(2Z)-penta-2,4-dienylidene]imidazolidine-1-carboxamide.
| Compound Name | (5E)-N-[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-3-(4-cyanobutyl)-2-oxo-5-[(2Z)-penta-2,4-dienylidene]imidazolidine-1-carboxamide |
|---|---|
| PubChem CID | 143642047 |
| Molecular Formula | C20H29N5O3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | (5E)-N-[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-3-(4-cyanobutyl)-2-oxo-5-[(2Z)-penta-2,4-dienylidene]imidazolidine-1-carboxamide |
| SMILES | C=C/C=C\C=C1/CN(CCCCC#N)C(=O)N1C(=O)N[C@H](C(N)=O)C(C)(C)C |
| InChI | InChI=1S/C20H29N5O3/c1-5-6-8-11-15-14-24(13-10-7-9-12-21)19(28)25(15)18(27)23-16(17(22)26)20(2,3)4/h5-6,8,11,16H,1,7,9-10,13-14H2,2-4H3,(H2,22,26)(H,23,27)/b8-6-,15-11+/t16-/m1/s1 |
| InChIKey | WVGNKSYSFZNNBG-WJQCDSHVSA-N |
| XLogP | 2.65 |
| TPSA | 119.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|