C23H31N — CID 143642288
2-tert-butyl-10-methyl-7-(2-methylbutan-2-yl)-9H-acridine (PubChem CID 143642288) has the molecular formula C23H31N and a molecular weight of 321.51 g/mol. Its IUPAC name is 2-tert-butyl-10-methyl-7-(2-methylbutan-2-yl)-9H-acridine.
| Compound Name | 2-tert-butyl-10-methyl-7-(2-methylbutan-2-yl)-9H-acridine |
|---|---|
| PubChem CID | 143642288 |
| Molecular Formula | C23H31N |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.25 |
| IUPAC Name | 2-tert-butyl-10-methyl-7-(2-methylbutan-2-yl)-9H-acridine |
| SMILES | CCC(C)(C)c1ccc2c(c1)Cc1cc(C(C)(C)C)ccc1N2C |
| InChI | InChI=1S/C23H31N/c1-8-23(5,6)19-10-12-21-17(15-19)13-16-14-18(22(2,3)4)9-11-20(16)24(21)7/h9-12,14-15H,8,13H2,1-7H3 |
| InChIKey | CBMIUWXEKUEGJU-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |