About [2-[(Z,3E)-3-[(E)-3-methoxyprop-2-enylidene]hept-4-en-2-yl]oxy-3-methylpentyl]cyclopropane
[2-[(Z,3E)-3-[(E)-3-methoxyprop-2-enylidene]hept-4-en-2-yl]oxy-3-methylpentyl]cyclopropane (PubChem CID 143642379) has the molecular formula C20H34O2
and a molecular weight of 306.49 g/mol. Its IUPAC name is [2-[(Z,3E)-3-[(E)-3-methoxyprop-2-enylidene]hept-4-en-2-yl]oxy-3-methylpentyl]cyclopropane.
Molecular Properties
| Compound Name | [2-[(Z,3E)-3-[(E)-3-methoxyprop-2-enylidene]hept-4-en-2-yl]oxy-3-methylpentyl]cyclopropane |
| PubChem CID | 143642379 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | [2-[(Z,3E)-3-[(E)-3-methoxyprop-2-enylidene]hept-4-en-2-yl]oxy-3-methylpentyl]cyclopropane |
| SMILES | CC/C=C\C(=C/C=C/OC)C(C)OC(CC1CC1)C(C)CC |
| InChI | InChI=1S/C20H34O2/c1-6-8-10-19(11-9-14-21-5)17(4)22-20(16(3)7-2)15-18-12-13-18/h8-11,14,16-18,20H,6-7,12-13,15H2,1-5H3/b10-8-,14-9+,19-11+ |
| InChIKey | RMTLOZAKXIUDIP-KSQJUOCXSA-N |
| XLogP | 5.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [2-[(Z,3E)-3-[(E)-3-methoxyprop-2-enylidene]hept-4-en-2-yl]oxy-3-methylpentyl]cyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(Z,3E)-3-[(E)-3-methoxyprop-2-enylidene]hept-4-en-2-yl]oxy-3-methylpentyl]cyclopropane?
The IUPAC name of [2-[(Z,3E)-3-[(E)-3-methoxyprop-2-enylidene]hept-4-en-2-yl]oxy-3-methylpentyl]cyclopropane (CID 143642379) is [2-[(Z,3E)-3-[(E)-3-methoxyprop-2-enylidene]hept-4-en-2-yl]oxy-3-methylpentyl]cyclopropane.
What is the SMILES notation for [2-[(Z,3E)-3-[(E)-3-methoxyprop-2-enylidene]hept-4-en-2-yl]oxy-3-methylpentyl]cyclopropane?
The canonical SMILES for [2-[(Z,3E)-3-[(E)-3-methoxyprop-2-enylidene]hept-4-en-2-yl]oxy-3-methylpentyl]cyclopropane is CC/C=C\C(=C/C=C/OC)C(C)OC(CC1CC1)C(C)CC.
What is the InChIKey of [2-[(Z,3E)-3-[(E)-3-methoxyprop-2-enylidene]hept-4-en-2-yl]oxy-3-methylpentyl]cyclopropane?
The InChIKey is RMTLOZAKXIUDIP-KSQJUOCXSA-N. The full InChI is InChI=1S/C20H34O2/c1-6-8-10-19(11-9-14-21-5)17(4)22-20(16(3)7-2)15-18-12-13-18/h8-11,14,16-18,20H,6-7,12-13,15H2,1-5H3/b10-8-,14-9+,19-11+.
What are the key properties of [2-[(Z,3E)-3-[(E)-3-methoxyprop-2-enylidene]hept-4-en-2-yl]oxy-3-methylpentyl]cyclopropane?
[2-[(Z,3E)-3-[(E)-3-methoxyprop-2-enylidene]hept-4-en-2-yl]oxy-3-methylpentyl]cyclopropane has a molecular weight of 306.49 g/mol, XLogP of 5.66, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(Z,3E)-3-[(E)-3-methoxyprop-2-enylidene]hept-4-en-2-yl]oxy-3-methylpentyl]cyclopropane is sourced from PubChem (CID 143642379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).