C28H37NO2 — CID 143642738
(5S,11Z)-N,N-diethyl-5-methyl-12-phenyl-2-oxabicyclo[11.4.0]heptadeca-1(13),11,14,16-tetraene-15-carboxamide (PubChem CID 143642738) has the molecular formula C28H37NO2 and a molecular weight of 419.61 g/mol. Its IUPAC name is (5S,11Z)-N,N-diethyl-5-methyl-12-phenyl-2-oxabicyclo[11.4.0]heptadeca-1(13),11,14,16-tetraene-15-carboxamide.
| Compound Name | (5S,11Z)-N,N-diethyl-5-methyl-12-phenyl-2-oxabicyclo[11.4.0]heptadeca-1(13),11,14,16-tetraene-15-carboxamide |
|---|---|
| PubChem CID | 143642738 |
| Molecular Formula | C28H37NO2 |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | (5S,11Z)-N,N-diethyl-5-methyl-12-phenyl-2-oxabicyclo[11.4.0]heptadeca-1(13),11,14,16-tetraene-15-carboxamide |
| SMILES | CCN(CC)C(=O)c1ccc2c(c1)/C(c1ccccc1)=C\CCCCC[C@H](C)CCO2 |
| InChI | InChI=1S/C28H37NO2/c1-4-29(5-2)28(30)24-17-18-27-26(21-24)25(23-14-10-8-11-15-23)16-12-7-6-9-13-22(3)19-20-31-27/h8,10-11,14-18,21-22H,4-7,9,12-13,19-20H2,1-3H3/b25-16-/t22-/m0/s1 |
| InChIKey | JWMYQGPUEAYMMM-TYGBLEFESA-N |
| XLogP | 6.97 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |