C21H33N5O3 — CID 143642889
12-[(dimethylamino)methyl]-7-methylidene-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-10,13-dione (PubChem CID 143642889) has the molecular formula C21H33N5O3 and a molecular weight of 403.53 g/mol. Its IUPAC name is 12-[(dimethylamino)methyl]-7-methylidene-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-10,13-dione.
| Compound Name | 12-[(dimethylamino)methyl]-7-methylidene-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-10,13-dione |
|---|---|
| PubChem CID | 143642889 |
| Molecular Formula | C21H33N5O3 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | 12-[(dimethylamino)methyl]-7-methylidene-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-10,13-dione |
| SMILES | C=C1CNCCOc2ccccc2CCCNC(=O)C(CN(C)C)NC(=O)CN1 |
| InChI | InChI=1S/C21H33N5O3/c1-16-13-22-11-12-29-19-9-5-4-7-17(19)8-6-10-23-21(28)18(15-26(2)3)25-20(27)14-24-16/h4-5,7,9,18,22,24H,1,6,8,10-15H2,2-3H3,(H,23,28)(H,25,27) |
| InChIKey | YLVJQMCDLNVLFG-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 94.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |