About 7-methoxy-2-[1-(methylamino)ethenyl]-1,2-dihydroquinolin-4-ol;propan-2-amine
7-methoxy-2-[1-(methylamino)ethenyl]-1,2-dihydroquinolin-4-ol;propan-2-amine (PubChem CID 143643341) has the molecular formula C16H25N3O2
and a molecular weight of 291.40 g/mol. Its IUPAC name is 7-methoxy-2-[1-(methylamino)ethenyl]-1,2-dihydroquinolin-4-ol;propan-2-amine.
Molecular Properties
| Compound Name | 7-methoxy-2-[1-(methylamino)ethenyl]-1,2-dihydroquinolin-4-ol;propan-2-amine |
| PubChem CID | 143643341 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 7-methoxy-2-[1-(methylamino)ethenyl]-1,2-dihydroquinolin-4-ol;propan-2-amine |
| SMILES | C=C(NC)C1C=C(O)c2ccc(OC)cc2N1.CC(C)N |
| InChI | InChI=1S/C13H16N2O2.C3H9N/c1-8(14-2)11-7-13(16)10-5-4-9(17-3)6-12(10)15-11;1-3(2)4/h4-7,11,14-16H,1H2,2-3H3;3H,4H2,1-2H3 |
| InChIKey | WWJOIDGGYFKMMK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-methoxy-2-[1-(methylamino)ethenyl]-1,2-dihydroquinolin-4-ol;propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-2-[1-(methylamino)ethenyl]-1,2-dihydroquinolin-4-ol;propan-2-amine?
The IUPAC name of 7-methoxy-2-[1-(methylamino)ethenyl]-1,2-dihydroquinolin-4-ol;propan-2-amine (CID 143643341) is 7-methoxy-2-[1-(methylamino)ethenyl]-1,2-dihydroquinolin-4-ol;propan-2-amine.
What is the SMILES notation for 7-methoxy-2-[1-(methylamino)ethenyl]-1,2-dihydroquinolin-4-ol;propan-2-amine?
The canonical SMILES for 7-methoxy-2-[1-(methylamino)ethenyl]-1,2-dihydroquinolin-4-ol;propan-2-amine is C=C(NC)C1C=C(O)c2ccc(OC)cc2N1.CC(C)N.
What is the InChIKey of 7-methoxy-2-[1-(methylamino)ethenyl]-1,2-dihydroquinolin-4-ol;propan-2-amine?
The InChIKey is WWJOIDGGYFKMMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O2.C3H9N/c1-8(14-2)11-7-13(16)10-5-4-9(17-3)6-12(10)15-11;1-3(2)4/h4-7,11,14-16H,1H2,2-3H3;3H,4H2,1-2H3.
What are the key properties of 7-methoxy-2-[1-(methylamino)ethenyl]-1,2-dihydroquinolin-4-ol;propan-2-amine?
7-methoxy-2-[1-(methylamino)ethenyl]-1,2-dihydroquinolin-4-ol;propan-2-amine has a molecular weight of 291.40 g/mol, XLogP of 2.47, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-2-[1-(methylamino)ethenyl]-1,2-dihydroquinolin-4-ol;propan-2-amine is sourced from PubChem (CID 143643341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).