C26H50N6O — CID 143643576
2-cyclohexyl-2-hydrazinyl-1-piperidin-1-ylethanone;(1-cyclohexyl-2-pyrrolidin-1-ylprop-2-enyl)hydrazine (PubChem CID 143643576) has the molecular formula C26H50N6O and a molecular weight of 462.73 g/mol. Its IUPAC name is 2-cyclohexyl-2-hydrazinyl-1-piperidin-1-ylethanone;(1-cyclohexyl-2-pyrrolidin-1-ylprop-2-enyl)hydrazine.
| Compound Name | 2-cyclohexyl-2-hydrazinyl-1-piperidin-1-ylethanone;(1-cyclohexyl-2-pyrrolidin-1-ylprop-2-enyl)hydrazine |
|---|---|
| PubChem CID | 143643576 |
| Molecular Formula | C26H50N6O |
| Molecular Weight | 462.73 g/mol |
| Exact Mass | 462.40 |
| IUPAC Name | 2-cyclohexyl-2-hydrazinyl-1-piperidin-1-ylethanone;(1-cyclohexyl-2-pyrrolidin-1-ylprop-2-enyl)hydrazine |
| SMILES | C=C(C(NN)C1CCCCC1)N1CCCC1.NNC(C(=O)N1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C13H25N3O.C13H25N3/c14-15-12(11-7-3-1-4-8-11)13(17)16-9-5-2-6-10-16;1-11(16-9-5-6-10-16)13(15-14)12-7-3-2-4-8-12/h11-12,15H,1-10,14H2;12-13,15H,1-10,14H2 |
| InChIKey | IFYHVBNPVIHBRV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 99.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.73 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|