C6H14N4 — CID 143643791
4,5-dimethyl-1,2,4-triazol-3-amine;ethane (PubChem CID 143643791) has the molecular formula C6H14N4 and a molecular weight of 142.21 g/mol. Its IUPAC name is 4,5-dimethyl-1,2,4-triazol-3-amine;ethane.
| Compound Name | 4,5-dimethyl-1,2,4-triazol-3-amine;ethane |
|---|---|
| PubChem CID | 143643791 |
| Molecular Formula | C6H14N4 |
| Molecular Weight | 142.21 g/mol |
| Exact Mass | 142.12 |
| IUPAC Name | 4,5-dimethyl-1,2,4-triazol-3-amine;ethane |
| SMILES | CC.Cc1nnc(N)n1C |
| InChI | InChI=1S/C4H8N4.C2H6/c1-3-6-7-4(5)8(3)2;1-2/h1-2H3,(H2,5,7);1-2H3 |
| InChIKey | JTWDNEBKSJNDPC-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.21 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |