About 5-[(Z)-but-1-enyl]-2,4-dimethylpyridine;ethane
5-[(Z)-but-1-enyl]-2,4-dimethylpyridine;ethane (PubChem CID 143643796) has the molecular formula C13H21N
and a molecular weight of 191.32 g/mol. Its IUPAC name is 5-[(Z)-but-1-enyl]-2,4-dimethylpyridine;ethane.
Molecular Properties
| Compound Name | 5-[(Z)-but-1-enyl]-2,4-dimethylpyridine;ethane |
| PubChem CID | 143643796 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 5-[(Z)-but-1-enyl]-2,4-dimethylpyridine;ethane |
| SMILES | CC.CC/C=C\c1cnc(C)cc1C |
| InChI | InChI=1S/C11H15N.C2H6/c1-4-5-6-11-8-12-10(3)7-9(11)2;1-2/h5-8H,4H2,1-3H3;1-2H3/b6-5-; |
| InChIKey | YYIWXLZZFSJELE-YSMBQZINSA-N |
| XLogP | 4.15 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-[(Z)-but-1-enyl]-2,4-dimethylpyridine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(Z)-but-1-enyl]-2,4-dimethylpyridine;ethane?
The IUPAC name of 5-[(Z)-but-1-enyl]-2,4-dimethylpyridine;ethane (CID 143643796) is 5-[(Z)-but-1-enyl]-2,4-dimethylpyridine;ethane.
What is the SMILES notation for 5-[(Z)-but-1-enyl]-2,4-dimethylpyridine;ethane?
The canonical SMILES for 5-[(Z)-but-1-enyl]-2,4-dimethylpyridine;ethane is CC.CC/C=C\c1cnc(C)cc1C.
What is the InChIKey of 5-[(Z)-but-1-enyl]-2,4-dimethylpyridine;ethane?
The InChIKey is YYIWXLZZFSJELE-YSMBQZINSA-N. The full InChI is InChI=1S/C11H15N.C2H6/c1-4-5-6-11-8-12-10(3)7-9(11)2;1-2/h5-8H,4H2,1-3H3;1-2H3/b6-5-;.
What are the key properties of 5-[(Z)-but-1-enyl]-2,4-dimethylpyridine;ethane?
5-[(Z)-but-1-enyl]-2,4-dimethylpyridine;ethane has a molecular weight of 191.32 g/mol, XLogP of 4.15, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(Z)-but-1-enyl]-2,4-dimethylpyridine;ethane is sourced from PubChem (CID 143643796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).