C14H27N3 — CID 143645269
(Z,2E)-6-[2-(dimethylamino)ethylimino]-2-ethylidene-N,5-dimethylhex-3-en-1-amine (PubChem CID 143645269) has the molecular formula C14H27N3 and a molecular weight of 237.39 g/mol. Its IUPAC name is (Z,2E)-6-[2-(dimethylamino)ethylimino]-2-ethylidene-N,5-dimethylhex-3-en-1-amine.
| Compound Name | (Z,2E)-6-[2-(dimethylamino)ethylimino]-2-ethylidene-N,5-dimethylhex-3-en-1-amine |
|---|---|
| PubChem CID | 143645269 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | (Z,2E)-6-[2-(dimethylamino)ethylimino]-2-ethylidene-N,5-dimethylhex-3-en-1-amine |
| SMILES | C/C=C(\C=C/C(C)/C=N/CCN(C)C)CNC |
| InChI | InChI=1S/C14H27N3/c1-6-14(12-15-3)8-7-13(2)11-16-9-10-17(4)5/h6-8,11,13,15H,9-10,12H2,1-5H3/b8-7-,14-6+,16-11+ |
| InChIKey | VLYIESWMUQTYOY-LVASIFQHSA-N |
| XLogP | 1.98 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|