C26H30N6O2 — CID 143645364
6-[[4-[4-(benzylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]methylamino]-N-hydroxyhexanamide (PubChem CID 143645364) has the molecular formula C26H30N6O2 and a molecular weight of 458.57 g/mol. Its IUPAC name is 6-[[4-[4-(benzylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]methylamino]-N-hydroxyhexanamide.
| Compound Name | 6-[[4-[4-(benzylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]methylamino]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 143645364 |
| Molecular Formula | C26H30N6O2 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | 6-[[4-[4-(benzylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]methylamino]-N-hydroxyhexanamide |
| SMILES | O=C(CCCCCNCc1ccc(-c2cc3c(NCc4ccccc4)ncnc3[nH]2)cc1)NO |
| InChI | InChI=1S/C26H30N6O2/c33-24(32-34)9-5-2-6-14-27-16-20-10-12-21(13-11-20)23-15-22-25(29-18-30-26(22)31-23)28-17-19-7-3-1-4-8-19/h1,3-4,7-8,10-13,15,18,27,34H,2,5-6,9,14,16-17H2,(H,32,33)(H2,28,29,30,31) |
| InChIKey | SCOPVEKTFNYHAU-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 114.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|