About (2E,4E)-N-methylhexa-2,4-dienamide
(2E,4E)-N-methylhexa-2,4-dienamide (PubChem CID 14364541) has the molecular formula C7H11NO
and a molecular weight of 125.17 g/mol. Its IUPAC name is (2E,4E)-N-methylhexa-2,4-dienamide.
Molecular Properties
| Compound Name | (2E,4E)-N-methylhexa-2,4-dienamide |
| PubChem CID | 14364541 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | (2E,4E)-N-methylhexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)NC |
| InChI | InChI=1S/C7H11NO/c1-3-4-5-6-7(9)8-2/h3-6H,1-2H3,(H,8,9)/b4-3+,6-5+ |
| InChIKey | PFCAKNKRSXYTRZ-VNKDHWASSA-N |
| XLogP | 0.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4E)-N-methylhexa-2,4-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4E)-N-methylhexa-2,4-dienamide?
The IUPAC name of (2E,4E)-N-methylhexa-2,4-dienamide (CID 14364541) is (2E,4E)-N-methylhexa-2,4-dienamide.
What is the SMILES notation for (2E,4E)-N-methylhexa-2,4-dienamide?
The canonical SMILES for (2E,4E)-N-methylhexa-2,4-dienamide is C/C=C/C=C/C(=O)NC.
What is the InChIKey of (2E,4E)-N-methylhexa-2,4-dienamide?
The InChIKey is PFCAKNKRSXYTRZ-VNKDHWASSA-N. The full InChI is InChI=1S/C7H11NO/c1-3-4-5-6-7(9)8-2/h3-6H,1-2H3,(H,8,9)/b4-3+,6-5+.
What are the key properties of (2E,4E)-N-methylhexa-2,4-dienamide?
(2E,4E)-N-methylhexa-2,4-dienamide has a molecular weight of 125.17 g/mol, XLogP of 0.86, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-N-methylhexa-2,4-dienamide is sourced from PubChem (CID 14364541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).