C33H45N7O3 — CID 143645448
6-[2-[4-[[4-[4-[[(2R,3E)-3-ethenylhexa-3,5-dien-2-yl]amino]-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]methyl]piperazin-1-yl]ethoxy]-N-hydroxyhexanamide (PubChem CID 143645448) has the molecular formula C33H45N7O3 and a molecular weight of 587.77 g/mol. Its IUPAC name is 6-[2-[4-[[4-[4-[[(2R,3E)-3-ethenylhexa-3,5-dien-2-yl]amino]-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]methyl]piperazin-1-yl]ethoxy]-N-hydroxyhexanamide.
| Compound Name | 6-[2-[4-[[4-[4-[[(2R,3E)-3-ethenylhexa-3,5-dien-2-yl]amino]-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]methyl]piperazin-1-yl]ethoxy]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 143645448 |
| Molecular Formula | C33H45N7O3 |
| Molecular Weight | 587.77 g/mol |
| Exact Mass | 587.36 |
| IUPAC Name | 6-[2-[4-[[4-[4-[[(2R,3E)-3-ethenylhexa-3,5-dien-2-yl]amino]-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]methyl]piperazin-1-yl]ethoxy]-N-hydroxyhexanamide |
| SMILES | C=C/C=C(\C=C)[C@@H](C)Nc1ncnc2[nH]c(-c3ccc(CN4CCN(CCOCCCCCC(=O)NO)CC4)cc3)cc12 |
| InChI | InChI=1S/C33H45N7O3/c1-4-9-27(5-2)25(3)36-32-29-22-30(37-33(29)35-24-34-32)28-13-11-26(12-14-28)23-40-17-15-39(16-18-40)19-21-43-20-8-6-7-10-31(41)38-42/h4-5,9,11-14,22,24-25,42H,1-2,6-8,10,15-21,23H2,3H3,(H,38,41)(H2,34,35,36,37)/b27-9+/t25-/m1/s1 |
| InChIKey | GIFBXPMNRKWBCP-SNVMMRONSA-N |
| XLogP | 4.92 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.77 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|