C20H25N3 — CID 143645901
6-ethenyl-5-[(1Z)-3-methylpenta-1,4-dienyl]-N-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]pyrimidin-4-amine (PubChem CID 143645901) has the molecular formula C20H25N3 and a molecular weight of 307.44 g/mol. Its IUPAC name is 6-ethenyl-5-[(1Z)-3-methylpenta-1,4-dienyl]-N-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]pyrimidin-4-amine.
| Compound Name | 6-ethenyl-5-[(1Z)-3-methylpenta-1,4-dienyl]-N-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 143645901 |
| Molecular Formula | C20H25N3 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | 6-ethenyl-5-[(1Z)-3-methylpenta-1,4-dienyl]-N-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]pyrimidin-4-amine |
| SMILES | C=Cc1ncnc(NC(/C=C\C=C/C)=C/C)c1/C=C\C(C)C=C |
| InChI | InChI=1S/C20H25N3/c1-6-10-11-12-17(8-3)23-20-18(14-13-16(5)7-2)19(9-4)21-15-22-20/h6-16H,2,4H2,1,3,5H3,(H,21,22,23)/b10-6-,12-11-,14-13-,17-8+ |
| InChIKey | IPMOASCNJBPSDA-QUZVORMHSA-N |
| XLogP | 5.40 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|