C11H21N3O2 — CID 143646639
pentyl N-[(E,4E)-4-(methylhydrazinylidene)but-1-enyl]carbamate (PubChem CID 143646639) has the molecular formula C11H21N3O2 and a molecular weight of 227.31 g/mol. Its IUPAC name is pentyl N-[(E,4E)-4-(methylhydrazinylidene)but-1-enyl]carbamate.
| Compound Name | pentyl N-[(E,4E)-4-(methylhydrazinylidene)but-1-enyl]carbamate |
|---|---|
| PubChem CID | 143646639 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | pentyl N-[(E,4E)-4-(methylhydrazinylidene)but-1-enyl]carbamate |
| SMILES | CCCCCOC(=O)N/C=C/C/C=N/NC |
| InChI | InChI=1S/C11H21N3O2/c1-3-4-7-10-16-11(15)13-8-5-6-9-14-12-2/h5,8-9,12H,3-4,6-7,10H2,1-2H3,(H,13,15)/b8-5+,14-9+ |
| InChIKey | VQUXFTKWURECPH-KBEUXKDCSA-N |
| XLogP | 2.01 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|