C18H21FN4O4S — CID 143647016
N-(2-aminoethyl)-4-[2-(hydroxymethyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]benzenesulfonamide;ethenyl hypofluorite (PubChem CID 143647016) has the molecular formula C18H21FN4O4S and a molecular weight of 408.46 g/mol. Its IUPAC name is N-(2-aminoethyl)-4-[2-(hydroxymethyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]benzenesulfonamide;ethenyl hypofluorite.
| Compound Name | N-(2-aminoethyl)-4-[2-(hydroxymethyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]benzenesulfonamide;ethenyl hypofluorite |
|---|---|
| PubChem CID | 143647016 |
| Molecular Formula | C18H21FN4O4S |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | N-(2-aminoethyl)-4-[2-(hydroxymethyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]benzenesulfonamide;ethenyl hypofluorite |
| SMILES | C=COF.NCCNS(=O)(=O)c1ccc(-c2ccnc3[nH]c(CO)cc23)cc1 |
| InChI | InChI=1S/C16H18N4O3S.C2H3FO/c17-6-8-19-24(22,23)13-3-1-11(2-4-13)14-5-7-18-16-15(14)9-12(10-21)20-16;1-2-4-3/h1-5,7,9,19,21H,6,8,10,17H2,(H,18,20);2H,1H2 |
| InChIKey | UMGLKVZTPNOIJW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 130.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|