C25H23N3O5S2 — CID 143647051
1-(benzenesulfonyl)-4-(4-piperidin-1-ylsulfonylphenyl)pyrrolo[2,3-b]pyridine-2-carbaldehyde (PubChem CID 143647051) has the molecular formula C25H23N3O5S2 and a molecular weight of 509.61 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-4-(4-piperidin-1-ylsulfonylphenyl)pyrrolo[2,3-b]pyridine-2-carbaldehyde.
| Compound Name | 1-(benzenesulfonyl)-4-(4-piperidin-1-ylsulfonylphenyl)pyrrolo[2,3-b]pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 143647051 |
| Molecular Formula | C25H23N3O5S2 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.11 |
| IUPAC Name | 1-(benzenesulfonyl)-4-(4-piperidin-1-ylsulfonylphenyl)pyrrolo[2,3-b]pyridine-2-carbaldehyde |
| SMILES | O=Cc1cc2c(-c3ccc(S(=O)(=O)N4CCCCC4)cc3)ccnc2n1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H23N3O5S2/c29-18-20-17-24-23(13-14-26-25(24)28(20)35(32,33)21-7-3-1-4-8-21)19-9-11-22(12-10-19)34(30,31)27-15-5-2-6-16-27/h1,3-4,7-14,17-18H,2,5-6,15-16H2 |
| InChIKey | OMFLUVZYIUEOCM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 106.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|