C37H45N5OS — CID 143648164
N'-[5-(4-cyanophenyl)sulfanyl-3-phenoxy-2-pyridinyl]-2-methyl-N-[(Z)-1-[1-[(E)-pent-2-en-2-yl]piperidin-4-yl]but-2-en-2-yl]butanimidamide (PubChem CID 143648164) has the molecular formula C37H45N5OS and a molecular weight of 607.87 g/mol. Its IUPAC name is N'-[5-(4-cyanophenyl)sulfanyl-3-phenoxy-2-pyridinyl]-2-methyl-N-[(Z)-1-[1-[(E)-pent-2-en-2-yl]piperidin-4-yl]but-2-en-2-yl]butanimidamide.
| Compound Name | N'-[5-(4-cyanophenyl)sulfanyl-3-phenoxy-2-pyridinyl]-2-methyl-N-[(Z)-1-[1-[(E)-pent-2-en-2-yl]piperidin-4-yl]but-2-en-2-yl]butanimidamide |
|---|---|
| PubChem CID | 143648164 |
| Molecular Formula | C37H45N5OS |
| Molecular Weight | 607.87 g/mol |
| Exact Mass | 607.33 |
| IUPAC Name | N'-[5-(4-cyanophenyl)sulfanyl-3-phenoxy-2-pyridinyl]-2-methyl-N-[(Z)-1-[1-[(E)-pent-2-en-2-yl]piperidin-4-yl]but-2-en-2-yl]butanimidamide |
| SMILES | C/C=C(/CC1CCN(/C(C)=C/CC)CC1)N/C(=N/c1ncc(Sc2ccc(C#N)cc2)cc1Oc1ccccc1)C(C)CC |
| InChI | InChI=1S/C37H45N5OS/c1-6-12-28(5)42-21-19-29(20-22-42)23-31(8-3)40-36(27(4)7-2)41-37-35(43-32-13-10-9-11-14-32)24-34(26-39-37)44-33-17-15-30(25-38)16-18-33/h8-18,24,26-27,29H,6-7,19-23H2,1-5H3,(H,39,40,41)/b28-12+,31-8- |
| InChIKey | TUWUKZZWKBNZAC-DLVBXESDSA-N |
| XLogP | 9.88 |
| TPSA | 73.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.87 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|