C19H21ClF2N2O — CID 143648382
N-[5-chloro-4-fluoro-2-[(3R,4R)-4-[(2Z,4Z)-6-fluoro-5-methylhepta-2,4,6-trienyl]pyrrolidin-3-yl]phenyl]formamide (PubChem CID 143648382) has the molecular formula C19H21ClF2N2O and a molecular weight of 366.84 g/mol. Its IUPAC name is N-[5-chloro-4-fluoro-2-[(3R,4R)-4-[(2Z,4Z)-6-fluoro-5-methylhepta-2,4,6-trienyl]pyrrolidin-3-yl]phenyl]formamide.
| Compound Name | N-[5-chloro-4-fluoro-2-[(3R,4R)-4-[(2Z,4Z)-6-fluoro-5-methylhepta-2,4,6-trienyl]pyrrolidin-3-yl]phenyl]formamide |
|---|---|
| PubChem CID | 143648382 |
| Molecular Formula | C19H21ClF2N2O |
| Molecular Weight | 366.84 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | N-[5-chloro-4-fluoro-2-[(3R,4R)-4-[(2Z,4Z)-6-fluoro-5-methylhepta-2,4,6-trienyl]pyrrolidin-3-yl]phenyl]formamide |
| SMILES | C=C(F)/C(C)=C\C=C/C[C@H]1CNC[C@H]1c1cc(F)c(Cl)cc1NC=O |
| InChI | InChI=1S/C19H21ClF2N2O/c1-12(13(2)21)5-3-4-6-14-9-23-10-16(14)15-7-18(22)17(20)8-19(15)24-11-25/h3-5,7-8,11,14,16,23H,2,6,9-10H2,1H3,(H,24,25)/b4-3-,12-5-/t14-,16+/m0/s1 |
| InChIKey | LNPIJRVFFPTAJF-ARCKXFTGSA-N |
| XLogP | 4.73 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.84 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|