C27H26F6N3O2S2+ — CID 143650003
(2E)-1-ethyl-2-[(1-ethylquinolin-1-ium-4-yl)methylidene]quinoline;4,4,5,5,6,6-hexafluoro-2-methyl-1,3,2-dithiazinane 1,3-dioxide (PubChem CID 143650003) has the molecular formula C27H26F6N3O2S2+ and a molecular weight of 602.65 g/mol. Its IUPAC name is (2E)-1-ethyl-2-[(1-ethylquinolin-1-ium-4-yl)methylidene]quinoline;4,4,5,5,6,6-hexafluoro-2-methyl-1,3,2-dithiazinane 1,3-dioxide.
| Compound Name | (2E)-1-ethyl-2-[(1-ethylquinolin-1-ium-4-yl)methylidene]quinoline;4,4,5,5,6,6-hexafluoro-2-methyl-1,3,2-dithiazinane 1,3-dioxide |
|---|---|
| PubChem CID | 143650003 |
| Molecular Formula | C27H26F6N3O2S2+ |
| Molecular Weight | 602.65 g/mol |
| Exact Mass | 602.14 |
| IUPAC Name | (2E)-1-ethyl-2-[(1-ethylquinolin-1-ium-4-yl)methylidene]quinoline;4,4,5,5,6,6-hexafluoro-2-methyl-1,3,2-dithiazinane 1,3-dioxide |
| SMILES | CCN1/C(=C/c2cc[n+](CC)c3ccccc23)C=Cc2ccccc21.CN1S(=O)C(F)(F)C(F)(F)C(F)(F)S1=O |
| InChI | InChI=1S/C23H23N2.C4H3F6NO2S2/c1-3-24-16-15-19(21-10-6-8-12-23(21)24)17-20-14-13-18-9-5-7-11-22(18)25(20)4-2;1-11-14(12)3(7,8)2(5,6)4(9,10)15(11)13/h5-17H,3-4H2,1-2H3;1H3/q+1; |
| InChIKey | ABAWAUDGWVOUFO-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 44.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.65 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|