C25H35F3N6O2S2 — CID 143650157
cyclohexyl 5-[[4-[2,4-dimethylpentan-2-yl(ethyl)amino]-2-(trifluoromethylsulfanylamino)phenyl]diazenyl]-1,3,4-thiadiazole-2-carboxylate (PubChem CID 143650157) has the molecular formula C25H35F3N6O2S2 and a molecular weight of 572.72 g/mol. Its IUPAC name is cyclohexyl 5-[[4-[2,4-dimethylpentan-2-yl(ethyl)amino]-2-(trifluoromethylsulfanylamino)phenyl]diazenyl]-1,3,4-thiadiazole-2-carboxylate.
| Compound Name | cyclohexyl 5-[[4-[2,4-dimethylpentan-2-yl(ethyl)amino]-2-(trifluoromethylsulfanylamino)phenyl]diazenyl]-1,3,4-thiadiazole-2-carboxylate |
|---|---|
| PubChem CID | 143650157 |
| Molecular Formula | C25H35F3N6O2S2 |
| Molecular Weight | 572.72 g/mol |
| Exact Mass | 572.22 |
| IUPAC Name | cyclohexyl 5-[[4-[2,4-dimethylpentan-2-yl(ethyl)amino]-2-(trifluoromethylsulfanylamino)phenyl]diazenyl]-1,3,4-thiadiazole-2-carboxylate |
| SMILES | CCN(c1ccc(/N=N/c2nnc(C(=O)OC3CCCCC3)s2)c(NSC(F)(F)F)c1)C(C)(C)CC(C)C |
| InChI | InChI=1S/C25H35F3N6O2S2/c1-6-34(24(4,5)15-16(2)3)17-12-13-19(20(14-17)33-38-25(26,27)28)29-31-23-32-30-21(37-23)22(35)36-18-10-8-7-9-11-18/h12-14,16,18,33H,6-11,15H2,1-5H3/b31-29+ |
| InChIKey | PKIJGAGYSOLFMT-OWWNRXNESA-N |
| XLogP | 8.67 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.72 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|