About 5-[(3R)-1-(2-hydroxypropanoyl)pyrrolidin-3-yl]-3H-1,3,4-thiadiazol-2-one
5-[(3R)-1-(2-hydroxypropanoyl)pyrrolidin-3-yl]-3H-1,3,4-thiadiazol-2-one (PubChem CID 143651133) has the molecular formula C9H13N3O3S
and a molecular weight of 243.29 g/mol. Its IUPAC name is 5-[(3R)-1-(2-hydroxypropanoyl)pyrrolidin-3-yl]-3H-1,3,4-thiadiazol-2-one.
Molecular Properties
| Compound Name | 5-[(3R)-1-(2-hydroxypropanoyl)pyrrolidin-3-yl]-3H-1,3,4-thiadiazol-2-one |
| PubChem CID | 143651133 |
| Molecular Formula | C9H13N3O3S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 5-[(3R)-1-(2-hydroxypropanoyl)pyrrolidin-3-yl]-3H-1,3,4-thiadiazol-2-one |
| SMILES | CC(O)C(=O)N1CC[C@@H](c2n[nH]c(=O)s2)C1 |
| InChI | InChI=1S/C9H13N3O3S/c1-5(13)8(14)12-3-2-6(4-12)7-10-11-9(15)16-7/h5-6,13H,2-4H2,1H3,(H,11,15)/t5?,6-/m1/s1 |
| InChIKey | LYBYAQXHJPUHFS-PRJDIBJQSA-N |
| XLogP | -0.47 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(3R)-1-(2-hydroxypropanoyl)pyrrolidin-3-yl]-3H-1,3,4-thiadiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3R)-1-(2-hydroxypropanoyl)pyrrolidin-3-yl]-3H-1,3,4-thiadiazol-2-one?
The IUPAC name of 5-[(3R)-1-(2-hydroxypropanoyl)pyrrolidin-3-yl]-3H-1,3,4-thiadiazol-2-one (CID 143651133) is 5-[(3R)-1-(2-hydroxypropanoyl)pyrrolidin-3-yl]-3H-1,3,4-thiadiazol-2-one.
What is the SMILES notation for 5-[(3R)-1-(2-hydroxypropanoyl)pyrrolidin-3-yl]-3H-1,3,4-thiadiazol-2-one?
The canonical SMILES for 5-[(3R)-1-(2-hydroxypropanoyl)pyrrolidin-3-yl]-3H-1,3,4-thiadiazol-2-one is CC(O)C(=O)N1CC[C@@H](c2n[nH]c(=O)s2)C1.
What is the InChIKey of 5-[(3R)-1-(2-hydroxypropanoyl)pyrrolidin-3-yl]-3H-1,3,4-thiadiazol-2-one?
The InChIKey is LYBYAQXHJPUHFS-PRJDIBJQSA-N. The full InChI is InChI=1S/C9H13N3O3S/c1-5(13)8(14)12-3-2-6(4-12)7-10-11-9(15)16-7/h5-6,13H,2-4H2,1H3,(H,11,15)/t5?,6-/m1/s1.
What are the key properties of 5-[(3R)-1-(2-hydroxypropanoyl)pyrrolidin-3-yl]-3H-1,3,4-thiadiazol-2-one?
5-[(3R)-1-(2-hydroxypropanoyl)pyrrolidin-3-yl]-3H-1,3,4-thiadiazol-2-one has a molecular weight of 243.29 g/mol, XLogP of -0.47, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3R)-1-(2-hydroxypropanoyl)pyrrolidin-3-yl]-3H-1,3,4-thiadiazol-2-one is sourced from PubChem (CID 143651133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).