C21H36Cl2N6 — CID 14365120
4,6-dichloro-N,N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazin-2-amine (PubChem CID 14365120) has the molecular formula C21H36Cl2N6 and a molecular weight of 443.47 g/mol. Its IUPAC name is 4,6-dichloro-N,N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4,6-dichloro-N,N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 14365120 |
| Molecular Formula | C21H36Cl2N6 |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 4,6-dichloro-N,N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazin-2-amine |
| SMILES | CC1(C)CC(N(c2nc(Cl)nc(Cl)n2)C2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C21H36Cl2N6/c1-18(2)9-13(10-19(3,4)27-18)29(17-25-15(22)24-16(23)26-17)14-11-20(5,6)28-21(7,8)12-14/h13-14,27-28H,9-12H2,1-8H3 |
| InChIKey | WADQMLNSADNKBZ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |