C41H76N8O2 — CID 14365123
4,6-bis[(1,2,2,6,6-pentamethylpiperidin-4-yl)oxy]-N,N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazin-2-amine (PubChem CID 14365123) has the molecular formula C41H76N8O2 and a molecular weight of 713.11 g/mol. Its IUPAC name is 4,6-bis[(1,2,2,6,6-pentamethylpiperidin-4-yl)oxy]-N,N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4,6-bis[(1,2,2,6,6-pentamethylpiperidin-4-yl)oxy]-N,N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 14365123 |
| Molecular Formula | C41H76N8O2 |
| Molecular Weight | 713.11 g/mol |
| Exact Mass | 712.61 |
| IUPAC Name | 4,6-bis[(1,2,2,6,6-pentamethylpiperidin-4-yl)oxy]-N,N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazin-2-amine |
| SMILES | CN1C(C)(C)CC(Oc2nc(OC3CC(C)(C)N(C)C(C)(C)C3)nc(N(C3CC(C)(C)NC(C)(C)C3)C3CC(C)(C)NC(C)(C)C3)n2)CC1(C)C |
| InChI | InChI=1S/C41H76N8O2/c1-34(2)19-27(20-35(3,4)45-34)49(28-21-36(5,6)46-37(7,8)22-28)31-42-32(50-29-23-38(9,10)47(17)39(11,12)24-29)44-33(43-31)51-30-25-40(13,14)48(18)41(15,16)26-30/h27-30,45-46H,19-26H2,1-18H3 |
| InChIKey | KRSUEFBBOOZNOG-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 90.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.11 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |