C47H90N10 — CID 14365133
4-N,6-N-diethyl-2-N,2-N,4-N,6-N-tetrakis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 14365133) has the molecular formula C47H90N10 and a molecular weight of 795.31 g/mol. Its IUPAC name is 4-N,6-N-diethyl-2-N,2-N,4-N,6-N-tetrakis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N,6-N-diethyl-2-N,2-N,4-N,6-N-tetrakis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 14365133 |
| Molecular Formula | C47H90N10 |
| Molecular Weight | 795.31 g/mol |
| Exact Mass | 794.73 |
| IUPAC Name | 4-N,6-N-diethyl-2-N,2-N,4-N,6-N-tetrakis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCN(c1nc(N(CC)C2CC(C)(C)N(C)C(C)(C)C2)nc(N(C2CC(C)(C)N(C)C(C)(C)C2)C2CC(C)(C)N(C)C(C)(C)C2)n1)C1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C47H90N10/c1-23-55(33-25-40(3,4)51(19)41(5,6)26-33)37-48-38(56(24-2)34-27-42(7,8)52(20)43(9,10)28-34)50-39(49-37)57(35-29-44(11,12)53(21)45(13,14)30-35)36-31-46(15,16)54(22)47(17,18)32-36/h33-36H,23-32H2,1-22H3 |
| InChIKey | YLIQBKSTTSZORI-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 61.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.31 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |