C51H98N10 — CID 14365134
4-N,6-N-dibutyl-2-N,2-N,4-N,6-N-tetrakis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 14365134) has the molecular formula C51H98N10 and a molecular weight of 851.41 g/mol. Its IUPAC name is 4-N,6-N-dibutyl-2-N,2-N,4-N,6-N-tetrakis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N,6-N-dibutyl-2-N,2-N,4-N,6-N-tetrakis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 14365134 |
| Molecular Formula | C51H98N10 |
| Molecular Weight | 851.41 g/mol |
| Exact Mass | 850.80 |
| IUPAC Name | 4-N,6-N-dibutyl-2-N,2-N,4-N,6-N-tetrakis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCN(c1nc(N(CCCC)C2CC(C)(C)N(C)C(C)(C)C2)nc(N(C2CC(C)(C)N(C)C(C)(C)C2)C2CC(C)(C)N(C)C(C)(C)C2)n1)C1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C51H98N10/c1-23-25-27-59(37-29-44(3,4)55(19)45(5,6)30-37)41-52-42(60(28-26-24-2)38-31-46(7,8)56(20)47(9,10)32-38)54-43(53-41)61(39-33-48(11,12)57(21)49(13,14)34-39)40-35-50(15,16)58(22)51(17,18)36-40/h37-40H,23-36H2,1-22H3 |
| InChIKey | OONDZGFEADKOSO-UHFFFAOYSA-N |
| XLogP | 10.50 |
| TPSA | 61.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.41 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |