C43H80N8O2 — CID 14365137
N,N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-4,6-bis[(1,2,2,6,6-pentamethylpiperidin-4-yl)oxy]-1,3,5-triazin-2-amine (PubChem CID 14365137) has the molecular formula C43H80N8O2 and a molecular weight of 741.17 g/mol. Its IUPAC name is N,N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-4,6-bis[(1,2,2,6,6-pentamethylpiperidin-4-yl)oxy]-1,3,5-triazin-2-amine.
| Compound Name | N,N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-4,6-bis[(1,2,2,6,6-pentamethylpiperidin-4-yl)oxy]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 14365137 |
| Molecular Formula | C43H80N8O2 |
| Molecular Weight | 741.17 g/mol |
| Exact Mass | 740.64 |
| IUPAC Name | N,N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-4,6-bis[(1,2,2,6,6-pentamethylpiperidin-4-yl)oxy]-1,3,5-triazin-2-amine |
| SMILES | CN1C(C)(C)CC(Oc2nc(OC3CC(C)(C)N(C)C(C)(C)C3)nc(N(C3CC(C)(C)N(C)C(C)(C)C3)C3CC(C)(C)N(C)C(C)(C)C3)n2)CC1(C)C |
| InChI | InChI=1S/C43H80N8O2/c1-36(2)21-29(22-37(3,4)47(36)17)51(30-23-38(5,6)48(18)39(7,8)24-30)33-44-34(52-31-25-40(9,10)49(19)41(11,12)26-31)46-35(45-33)53-32-27-42(13,14)50(20)43(15,16)28-32/h29-32H,21-28H2,1-20H3 |
| InChIKey | ZSCJGGKNZXYJDV-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.17 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |