C52H100N10 — CID 14365138
6-N-methyl-6-N-octyl-2-N,2-N,4-N,4-N-tetrakis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 14365138) has the molecular formula C52H100N10 and a molecular weight of 865.44 g/mol. Its IUPAC name is 6-N-methyl-6-N-octyl-2-N,2-N,4-N,4-N-tetrakis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-methyl-6-N-octyl-2-N,2-N,4-N,4-N-tetrakis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 14365138 |
| Molecular Formula | C52H100N10 |
| Molecular Weight | 865.44 g/mol |
| Exact Mass | 864.81 |
| IUPAC Name | 6-N-methyl-6-N-octyl-2-N,2-N,4-N,4-N-tetrakis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCCCCCN(C)c1nc(N(C2CC(C)(C)N(C)C(C)(C)C2)C2CC(C)(C)N(C)C(C)(C)C2)nc(N(C2CC(C)(C)N(C)C(C)(C)C2)C2CC(C)(C)N(C)C(C)(C)C2)n1 |
| InChI | InChI=1S/C52H100N10/c1-23-24-25-26-27-28-29-56(18)42-53-43(61(38-30-45(2,3)57(19)46(4,5)31-38)39-32-47(6,7)58(20)48(8,9)33-39)55-44(54-42)62(40-34-49(10,11)59(21)50(12,13)35-40)41-36-51(14,15)60(22)52(16,17)37-41/h38-41H,23-37H2,1-22H3 |
| InChIKey | QHFLIPSRAINCEZ-UHFFFAOYSA-N |
| XLogP | 10.89 |
| TPSA | 61.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.44 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|