C22H23IN4O3 — CID 143651514
N-[[3-(2-hydroxypiperidin-3-yl)-2-methyl-4-oxoquinazolin-5-yl]methyl]-4-iodobenzamide (PubChem CID 143651514) has the molecular formula C22H23IN4O3 and a molecular weight of 518.36 g/mol. Its IUPAC name is N-[[3-(2-hydroxypiperidin-3-yl)-2-methyl-4-oxoquinazolin-5-yl]methyl]-4-iodobenzamide.
| Compound Name | N-[[3-(2-hydroxypiperidin-3-yl)-2-methyl-4-oxoquinazolin-5-yl]methyl]-4-iodobenzamide |
|---|---|
| PubChem CID | 143651514 |
| Molecular Formula | C22H23IN4O3 |
| Molecular Weight | 518.36 g/mol |
| Exact Mass | 518.08 |
| IUPAC Name | N-[[3-(2-hydroxypiperidin-3-yl)-2-methyl-4-oxoquinazolin-5-yl]methyl]-4-iodobenzamide |
| SMILES | Cc1nc2cccc(CNC(=O)c3ccc(I)cc3)c2c(=O)n1C1CCCNC1O |
| InChI | InChI=1S/C22H23IN4O3/c1-13-26-17-5-2-4-15(12-25-20(28)14-7-9-16(23)10-8-14)19(17)22(30)27(13)18-6-3-11-24-21(18)29/h2,4-5,7-10,18,21,24,29H,3,6,11-12H2,1H3,(H,25,28) |
| InChIKey | GXLDQXAIKWRZJH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|