C20H16BrF2N3O2S — CID 143651657
N-[5-[5-bromo-2-[(dimethylamino)methyl]phenyl]-4-formyl-1,3-thiazol-2-yl]-2,6-difluorobenzamide (PubChem CID 143651657) has the molecular formula C20H16BrF2N3O2S and a molecular weight of 480.33 g/mol. Its IUPAC name is N-[5-[5-bromo-2-[(dimethylamino)methyl]phenyl]-4-formyl-1,3-thiazol-2-yl]-2,6-difluorobenzamide.
| Compound Name | N-[5-[5-bromo-2-[(dimethylamino)methyl]phenyl]-4-formyl-1,3-thiazol-2-yl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 143651657 |
| Molecular Formula | C20H16BrF2N3O2S |
| Molecular Weight | 480.33 g/mol |
| Exact Mass | 479.01 |
| IUPAC Name | N-[5-[5-bromo-2-[(dimethylamino)methyl]phenyl]-4-formyl-1,3-thiazol-2-yl]-2,6-difluorobenzamide |
| SMILES | CN(C)Cc1ccc(Br)cc1-c1sc(NC(=O)c2c(F)cccc2F)nc1C=O |
| InChI | InChI=1S/C20H16BrF2N3O2S/c1-26(2)9-11-6-7-12(21)8-13(11)18-16(10-27)24-20(29-18)25-19(28)17-14(22)4-3-5-15(17)23/h3-8,10H,9H2,1-2H3,(H,24,25,28) |
| InChIKey | ZVTQXBJWMOLFDO-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.33 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|