C29H27NO3 — CID 143652057
5-[2-hydroxy-4-[(3E,5E)-5-hydroxyhepta-1,3,5-trien-3-yl]phenyl]-1-(4-phenylphenyl)pyrrolidin-2-one (PubChem CID 143652057) has the molecular formula C29H27NO3 and a molecular weight of 437.54 g/mol. Its IUPAC name is 5-[2-hydroxy-4-[(3E,5E)-5-hydroxyhepta-1,3,5-trien-3-yl]phenyl]-1-(4-phenylphenyl)pyrrolidin-2-one.
| Compound Name | 5-[2-hydroxy-4-[(3E,5E)-5-hydroxyhepta-1,3,5-trien-3-yl]phenyl]-1-(4-phenylphenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 143652057 |
| Molecular Formula | C29H27NO3 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 5-[2-hydroxy-4-[(3E,5E)-5-hydroxyhepta-1,3,5-trien-3-yl]phenyl]-1-(4-phenylphenyl)pyrrolidin-2-one |
| SMILES | C=C/C(=C\C(O)=C/C)c1ccc(C2CCC(=O)N2c2ccc(-c3ccccc3)cc2)c(O)c1 |
| InChI | InChI=1S/C29H27NO3/c1-3-20(18-25(31)4-2)23-12-15-26(28(32)19-23)27-16-17-29(33)30(27)24-13-10-22(11-14-24)21-8-6-5-7-9-21/h3-15,18-19,27,31-32H,1,16-17H2,2H3/b20-18+,25-4+ |
| InChIKey | NHRHLHQBISFXDY-GPFKRVCUSA-N |
| XLogP | 6.96 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|