C15H17ClIN3O — CID 143652236
N-[2-(4-chlorophenyl)ethyl]-2-(1-iodoethoxy)-6-methylpyrimidin-4-amine (PubChem CID 143652236) has the molecular formula C15H17ClIN3O and a molecular weight of 417.68 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-2-(1-iodoethoxy)-6-methylpyrimidin-4-amine.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-2-(1-iodoethoxy)-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 143652236 |
| Molecular Formula | C15H17ClIN3O |
| Molecular Weight | 417.68 g/mol |
| Exact Mass | 417.01 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-2-(1-iodoethoxy)-6-methylpyrimidin-4-amine |
| SMILES | Cc1cc(NCCc2ccc(Cl)cc2)nc(OC(C)I)n1 |
| InChI | InChI=1S/C15H17ClIN3O/c1-10-9-14(20-15(19-10)21-11(2)17)18-8-7-12-3-5-13(16)6-4-12/h3-6,9,11H,7-8H2,1-2H3,(H,18,19,20) |
| InChIKey | SLALWVZJDFFTGB-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.68 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|