About ethane;4-methoxy-7-methyl-9-prop-2-ynoxyfuro[3,2-g]chromen-5-one
ethane;4-methoxy-7-methyl-9-prop-2-ynoxyfuro[3,2-g]chromen-5-one (PubChem CID 143652322) has the molecular formula C20H24O5
and a molecular weight of 344.41 g/mol. Its IUPAC name is ethane;4-methoxy-7-methyl-9-prop-2-ynoxyfuro[3,2-g]chromen-5-one.
Molecular Properties
| Compound Name | ethane;4-methoxy-7-methyl-9-prop-2-ynoxyfuro[3,2-g]chromen-5-one |
| PubChem CID | 143652322 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | ethane;4-methoxy-7-methyl-9-prop-2-ynoxyfuro[3,2-g]chromen-5-one |
| SMILES | C#CCOc1c2occc2c(OC)c2c(=O)cc(C)oc12.CC.CC |
| InChI | InChI=1S/C16H12O5.2C2H6/c1-4-6-19-16-14-10(5-7-20-14)13(18-3)12-11(17)8-9(2)21-15(12)16;2*1-2/h1,5,7-8H,6H2,2-3H3;2*1-2H3 |
| InChIKey | NPWCJJNIHBDFJP-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 61.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-methoxy-7-methyl-9-prop-2-ynoxyfuro[3,2-g]chromen-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methoxy-7-methyl-9-prop-2-ynoxyfuro[3,2-g]chromen-5-one?
The IUPAC name of ethane;4-methoxy-7-methyl-9-prop-2-ynoxyfuro[3,2-g]chromen-5-one (CID 143652322) is ethane;4-methoxy-7-methyl-9-prop-2-ynoxyfuro[3,2-g]chromen-5-one.
What is the SMILES notation for ethane;4-methoxy-7-methyl-9-prop-2-ynoxyfuro[3,2-g]chromen-5-one?
The canonical SMILES for ethane;4-methoxy-7-methyl-9-prop-2-ynoxyfuro[3,2-g]chromen-5-one is C#CCOc1c2occc2c(OC)c2c(=O)cc(C)oc12.CC.CC.
What is the InChIKey of ethane;4-methoxy-7-methyl-9-prop-2-ynoxyfuro[3,2-g]chromen-5-one?
The InChIKey is NPWCJJNIHBDFJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12O5.2C2H6/c1-4-6-19-16-14-10(5-7-20-14)13(18-3)12-11(17)8-9(2)21-15(12)16;2*1-2/h1,5,7-8H,6H2,2-3H3;2*1-2H3.
What are the key properties of ethane;4-methoxy-7-methyl-9-prop-2-ynoxyfuro[3,2-g]chromen-5-one?
ethane;4-methoxy-7-methyl-9-prop-2-ynoxyfuro[3,2-g]chromen-5-one has a molecular weight of 344.41 g/mol, XLogP of 4.92, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methoxy-7-methyl-9-prop-2-ynoxyfuro[3,2-g]chromen-5-one is sourced from PubChem (CID 143652322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).