About ethane;2-methylbutane;1-pentan-3-yl-2,3-dihydropyrrole
ethane;2-methylbutane;1-pentan-3-yl-2,3-dihydropyrrole (PubChem CID 143653250) has the molecular formula C16H35N
and a molecular weight of 241.46 g/mol. Its IUPAC name is ethane;2-methylbutane;1-pentan-3-yl-2,3-dihydropyrrole.
Molecular Properties
| Compound Name | ethane;2-methylbutane;1-pentan-3-yl-2,3-dihydropyrrole |
| PubChem CID | 143653250 |
| Molecular Formula | C16H35N |
| Molecular Weight | 241.46 g/mol |
| Exact Mass | 241.28 |
| IUPAC Name | ethane;2-methylbutane;1-pentan-3-yl-2,3-dihydropyrrole |
| SMILES | CC.CCC(C)C.CCC(CC)N1C=CCC1 |
| InChI | InChI=1S/C9H17N.C5H12.C2H6/c1-3-9(4-2)10-7-5-6-8-10;1-4-5(2)3;1-2/h5,7,9H,3-4,6,8H2,1-2H3;5H,4H2,1-3H3;1-2H3 |
| InChIKey | OORHTRPBTXDCFR-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 241.46 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2-methylbutane;1-pentan-3-yl-2,3-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylbutane;1-pentan-3-yl-2,3-dihydropyrrole?
The IUPAC name of ethane;2-methylbutane;1-pentan-3-yl-2,3-dihydropyrrole (CID 143653250) is ethane;2-methylbutane;1-pentan-3-yl-2,3-dihydropyrrole.
What is the SMILES notation for ethane;2-methylbutane;1-pentan-3-yl-2,3-dihydropyrrole?
The canonical SMILES for ethane;2-methylbutane;1-pentan-3-yl-2,3-dihydropyrrole is CC.CCC(C)C.CCC(CC)N1C=CCC1.
What is the InChIKey of ethane;2-methylbutane;1-pentan-3-yl-2,3-dihydropyrrole?
The InChIKey is OORHTRPBTXDCFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N.C5H12.C2H6/c1-3-9(4-2)10-7-5-6-8-10;1-4-5(2)3;1-2/h5,7,9H,3-4,6,8H2,1-2H3;5H,4H2,1-3H3;1-2H3.
What are the key properties of ethane;2-methylbutane;1-pentan-3-yl-2,3-dihydropyrrole?
ethane;2-methylbutane;1-pentan-3-yl-2,3-dihydropyrrole has a molecular weight of 241.46 g/mol, XLogP of 5.47, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylbutane;1-pentan-3-yl-2,3-dihydropyrrole is sourced from PubChem (CID 143653250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).