About buta-1,3-diene;2-(quinolin-4-ylmethyl)pyrrolidin-2-amine
buta-1,3-diene;2-(quinolin-4-ylmethyl)pyrrolidin-2-amine (PubChem CID 143653496) has the molecular formula C18H23N3
and a molecular weight of 281.40 g/mol. Its IUPAC name is buta-1,3-diene;2-(quinolin-4-ylmethyl)pyrrolidin-2-amine.
Molecular Properties
| Compound Name | buta-1,3-diene;2-(quinolin-4-ylmethyl)pyrrolidin-2-amine |
| PubChem CID | 143653496 |
| Molecular Formula | C18H23N3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | buta-1,3-diene;2-(quinolin-4-ylmethyl)pyrrolidin-2-amine |
| SMILES | C=CC=C.NC1(Cc2ccnc3ccccc23)CCCN1 |
| InChI | InChI=1S/C14H17N3.C4H6/c15-14(7-3-8-17-14)10-11-6-9-16-13-5-2-1-4-12(11)13;1-3-4-2/h1-2,4-6,9,17H,3,7-8,10,15H2;3-4H,1-2H2 |
| InChIKey | PLSBQHDVZKJZJT-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze buta-1,3-diene;2-(quinolin-4-ylmethyl)pyrrolidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of buta-1,3-diene;2-(quinolin-4-ylmethyl)pyrrolidin-2-amine?
The IUPAC name of buta-1,3-diene;2-(quinolin-4-ylmethyl)pyrrolidin-2-amine (CID 143653496) is buta-1,3-diene;2-(quinolin-4-ylmethyl)pyrrolidin-2-amine.
What is the SMILES notation for buta-1,3-diene;2-(quinolin-4-ylmethyl)pyrrolidin-2-amine?
The canonical SMILES for buta-1,3-diene;2-(quinolin-4-ylmethyl)pyrrolidin-2-amine is C=CC=C.NC1(Cc2ccnc3ccccc23)CCCN1.
What is the InChIKey of buta-1,3-diene;2-(quinolin-4-ylmethyl)pyrrolidin-2-amine?
The InChIKey is PLSBQHDVZKJZJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3.C4H6/c15-14(7-3-8-17-14)10-11-6-9-16-13-5-2-1-4-12(11)13;1-3-4-2/h1-2,4-6,9,17H,3,7-8,10,15H2;3-4H,1-2H2.
What are the key properties of buta-1,3-diene;2-(quinolin-4-ylmethyl)pyrrolidin-2-amine?
buta-1,3-diene;2-(quinolin-4-ylmethyl)pyrrolidin-2-amine has a molecular weight of 281.40 g/mol, XLogP of 3.17, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for buta-1,3-diene;2-(quinolin-4-ylmethyl)pyrrolidin-2-amine is sourced from PubChem (CID 143653496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).