C12H9ClN4O5 — CID 143653607
10-carbonochloridoyl-2,8-dioxo-1,5,7,11-tetrazatricyclo[7.3.0.03,7]dodeca-3,5,9,11-tetraene-4-carboxylic acid;ethane (PubChem CID 143653607) has the molecular formula C12H9ClN4O5 and a molecular weight of 324.68 g/mol. Its IUPAC name is 10-carbonochloridoyl-2,8-dioxo-1,5,7,11-tetrazatricyclo[7.3.0.03,7]dodeca-3,5,9,11-tetraene-4-carboxylic acid;ethane.
| Compound Name | 10-carbonochloridoyl-2,8-dioxo-1,5,7,11-tetrazatricyclo[7.3.0.03,7]dodeca-3,5,9,11-tetraene-4-carboxylic acid;ethane |
|---|---|
| PubChem CID | 143653607 |
| Molecular Formula | C12H9ClN4O5 |
| Molecular Weight | 324.68 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 10-carbonochloridoyl-2,8-dioxo-1,5,7,11-tetrazatricyclo[7.3.0.03,7]dodeca-3,5,9,11-tetraene-4-carboxylic acid;ethane |
| SMILES | CC.O=C(O)c1ncn2c(=O)c3c(C(=O)Cl)ncn3c(=O)c12 |
| InChI | InChI=1S/C10H3ClN4O5.C2H6/c11-7(16)3-5-8(17)15-2-13-4(10(19)20)6(15)9(18)14(5)1-12-3;1-2/h1-2H,(H,19,20);1-2H3 |
| InChIKey | XNTOHBBPVWFWCN-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 123.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.68 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|