C14H23NO — CID 143653662
2-[methyl-[(3Z,4Z,6Z)-3-prop-2-enylideneocta-4,6-dienyl]amino]ethanol (PubChem CID 143653662) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 2-[methyl-[(3Z,4Z,6Z)-3-prop-2-enylideneocta-4,6-dienyl]amino]ethanol.
| Compound Name | 2-[methyl-[(3Z,4Z,6Z)-3-prop-2-enylideneocta-4,6-dienyl]amino]ethanol |
|---|---|
| PubChem CID | 143653662 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 2-[methyl-[(3Z,4Z,6Z)-3-prop-2-enylideneocta-4,6-dienyl]amino]ethanol |
| SMILES | C=C/C=C(\C=C/C=C\C)CCN(C)CCO |
| InChI | InChI=1S/C14H23NO/c1-4-6-7-9-14(8-5-2)10-11-15(3)12-13-16/h4-9,16H,2,10-13H2,1,3H3/b6-4-,9-7-,14-8+ |
| InChIKey | SCPZZFNTWBRMTB-DHXQLIAASA-N |
| XLogP | 2.55 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|