C26H36FNO2 — CID 143653874
(3S,8aS)-3-methyl-3a,4,4a,5,6,7,8,8a,9,9a-decahydro-3H-benzo[f][1]benzofuran-2-one;2-ethenyl-5-(4-fluorophenyl)pyridine;molecular hydrogen (PubChem CID 143653874) has the molecular formula C26H36FNO2 and a molecular weight of 413.58 g/mol. Its IUPAC name is (3S,8aS)-3-methyl-3a,4,4a,5,6,7,8,8a,9,9a-decahydro-3H-benzo[f][1]benzofuran-2-one;2-ethenyl-5-(4-fluorophenyl)pyridine;molecular hydrogen.
| Compound Name | (3S,8aS)-3-methyl-3a,4,4a,5,6,7,8,8a,9,9a-decahydro-3H-benzo[f][1]benzofuran-2-one;2-ethenyl-5-(4-fluorophenyl)pyridine;molecular hydrogen |
|---|---|
| PubChem CID | 143653874 |
| Molecular Formula | C26H36FNO2 |
| Molecular Weight | 413.58 g/mol |
| Exact Mass | 413.27 |
| IUPAC Name | (3S,8aS)-3-methyl-3a,4,4a,5,6,7,8,8a,9,9a-decahydro-3H-benzo[f][1]benzofuran-2-one;2-ethenyl-5-(4-fluorophenyl)pyridine;molecular hydrogen |
| SMILES | C=Cc1ccc(-c2ccc(F)cc2)cn1.C[C@@H]1C(=O)OC2C[C@@H]3CCCCC3CC21.[H][H].[H][H].[H][H] |
| InChI | InChI=1S/C13H10FN.C13H20O2.3H2/c1-2-13-8-5-11(9-15-13)10-3-6-12(14)7-4-10;1-8-11-6-9-4-2-3-5-10(9)7-12(11)15-13(8)14;;;/h2-9H,1H2;8-12H,2-7H2,1H3;3*1H/t;8-,9?,10-,11?,12?;;;/m.0.../s1 |
| InChIKey | FUGJYAMHZJNPID-GCRZOOSESA-N |
| XLogP | 7.03 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.58 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |