C20H12BrF6N5O — CID 143654046
[2-[5-cyano-2-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)indol-1-yl]ethanimidoyl] 5-bromopyridine-3-carboximidate (PubChem CID 143654046) has the molecular formula C20H12BrF6N5O and a molecular weight of 532.24 g/mol. Its IUPAC name is [2-[5-cyano-2-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)indol-1-yl]ethanimidoyl] 5-bromopyridine-3-carboximidate.
| Compound Name | [2-[5-cyano-2-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)indol-1-yl]ethanimidoyl] 5-bromopyridine-3-carboximidate |
|---|---|
| PubChem CID | 143654046 |
| Molecular Formula | C20H12BrF6N5O |
| Molecular Weight | 532.24 g/mol |
| Exact Mass | 531.01 |
| IUPAC Name | [2-[5-cyano-2-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)indol-1-yl]ethanimidoyl] 5-bromopyridine-3-carboximidate |
| SMILES | [H]/N=C(/Cn1c(CC(F)(F)F)cc2c(C(F)(F)F)c(C#N)ccc21)O/C(=N/[H])c1cncc(Br)c1 |
| InChI | InChI=1S/C20H12BrF6N5O/c21-12-3-11(7-31-8-12)18(30)33-16(29)9-32-13(5-19(22,23)24)4-14-15(32)2-1-10(6-28)17(14)20(25,26)27/h1-4,7-8,29-30H,5,9H2/b29-16-,30-18+ |
| InChIKey | RYKNMWYKXNRUQW-NNLWNKRPSA-N |
| XLogP | 5.81 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.24 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|