C21H22F3NO3 — CID 143654083
ethyl formate;2-methyl-5-phenylmethoxy-1-(2,2,2-trifluoroethyl)indole (PubChem CID 143654083) has the molecular formula C21H22F3NO3 and a molecular weight of 393.41 g/mol. Its IUPAC name is ethyl formate;2-methyl-5-phenylmethoxy-1-(2,2,2-trifluoroethyl)indole.
| Compound Name | ethyl formate;2-methyl-5-phenylmethoxy-1-(2,2,2-trifluoroethyl)indole |
|---|---|
| PubChem CID | 143654083 |
| Molecular Formula | C21H22F3NO3 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | ethyl formate;2-methyl-5-phenylmethoxy-1-(2,2,2-trifluoroethyl)indole |
| SMILES | CCOC=O.Cc1cc2cc(OCc3ccccc3)ccc2n1CC(F)(F)F |
| InChI | InChI=1S/C18H16F3NO.C3H6O2/c1-13-9-15-10-16(23-11-14-5-3-2-4-6-14)7-8-17(15)22(13)12-18(19,20)21;1-2-5-3-4/h2-10H,11-12H2,1H3;3H,2H2,1H3 |
| InChIKey | CLPSUIOOOHBCCQ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|