About 1-(5-pyridin-3-yl-1,3-oxazol-2-yl)-3-(4-quinazolin-4-yloxyphenyl)urea
1-(5-pyridin-3-yl-1,3-oxazol-2-yl)-3-(4-quinazolin-4-yloxyphenyl)urea (PubChem CID 143654279) has the molecular formula C23H16N6O3
and a molecular weight of 424.42 g/mol. Its IUPAC name is 1-(5-pyridin-3-yl-1,3-oxazol-2-yl)-3-(4-quinazolin-4-yloxyphenyl)urea.
Molecular Properties
| Compound Name | 1-(5-pyridin-3-yl-1,3-oxazol-2-yl)-3-(4-quinazolin-4-yloxyphenyl)urea |
| PubChem CID | 143654279 |
| Molecular Formula | C23H16N6O3 |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 1-(5-pyridin-3-yl-1,3-oxazol-2-yl)-3-(4-quinazolin-4-yloxyphenyl)urea |
| SMILES | O=C(Nc1ccc(Oc2ncnc3ccccc23)cc1)Nc1ncc(-c2cccnc2)o1 |
| InChI | InChI=1S/C23H16N6O3/c30-22(29-23-25-13-20(32-23)15-4-3-11-24-12-15)28-16-7-9-17(10-8-16)31-21-18-5-1-2-6-19(18)26-14-27-21/h1-14H,(H2,25,28,29,30) |
| InChIKey | CKCFJVXVNLQTGA-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-(5-pyridin-3-yl-1,3-oxazol-2-yl)-3-(4-quinazolin-4-yloxyphenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-pyridin-3-yl-1,3-oxazol-2-yl)-3-(4-quinazolin-4-yloxyphenyl)urea?
The IUPAC name of 1-(5-pyridin-3-yl-1,3-oxazol-2-yl)-3-(4-quinazolin-4-yloxyphenyl)urea (CID 143654279) is 1-(5-pyridin-3-yl-1,3-oxazol-2-yl)-3-(4-quinazolin-4-yloxyphenyl)urea.
What is the SMILES notation for 1-(5-pyridin-3-yl-1,3-oxazol-2-yl)-3-(4-quinazolin-4-yloxyphenyl)urea?
The canonical SMILES for 1-(5-pyridin-3-yl-1,3-oxazol-2-yl)-3-(4-quinazolin-4-yloxyphenyl)urea is O=C(Nc1ccc(Oc2ncnc3ccccc23)cc1)Nc1ncc(-c2cccnc2)o1.
What is the InChIKey of 1-(5-pyridin-3-yl-1,3-oxazol-2-yl)-3-(4-quinazolin-4-yloxyphenyl)urea?
The InChIKey is CKCFJVXVNLQTGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16N6O3/c30-22(29-23-25-13-20(32-23)15-4-3-11-24-12-15)28-16-7-9-17(10-8-16)31-21-18-5-1-2-6-19(18)26-14-27-21/h1-14H,(H2,25,28,29,30).
What are the key properties of 1-(5-pyridin-3-yl-1,3-oxazol-2-yl)-3-(4-quinazolin-4-yloxyphenyl)urea?
1-(5-pyridin-3-yl-1,3-oxazol-2-yl)-3-(4-quinazolin-4-yloxyphenyl)urea has a molecular weight of 424.42 g/mol, XLogP of 5.12, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-pyridin-3-yl-1,3-oxazol-2-yl)-3-(4-quinazolin-4-yloxyphenyl)urea is sourced from PubChem (CID 143654279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).