C12H12F3NO2 — CID 143654538
3,4-dihydro-2H-naphthalen-1-one;2,2,2-trifluoroacetamide (PubChem CID 143654538) has the molecular formula C12H12F3NO2 and a molecular weight of 259.23 g/mol. Its IUPAC name is 3,4-dihydro-2H-naphthalen-1-one;2,2,2-trifluoroacetamide.
| Compound Name | 3,4-dihydro-2H-naphthalen-1-one;2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 143654538 |
| Molecular Formula | C12H12F3NO2 |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 3,4-dihydro-2H-naphthalen-1-one;2,2,2-trifluoroacetamide |
| SMILES | NC(=O)C(F)(F)F.O=C1CCCc2ccccc21 |
| InChI | InChI=1S/C10H10O.C2H2F3NO/c11-10-7-3-5-8-4-1-2-6-9(8)10;3-2(4,5)1(6)7/h1-2,4,6H,3,5,7H2;(H2,6,7) |
| InChIKey | KFLWCSCUTWKVKQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |