C21H18N2O3S2 — CID 143654880
(5Z)-3-(1,3-benzodioxol-5-ylmethyl)-5-[2-(1H-indol-3-yl)ethylidene]-2-sulfanylidene-1,3-thiazolidin-4-one;molecular hydrogen (PubChem CID 143654880) has the molecular formula C21H18N2O3S2 and a molecular weight of 410.52 g/mol. Its IUPAC name is (5Z)-3-(1,3-benzodioxol-5-ylmethyl)-5-[2-(1H-indol-3-yl)ethylidene]-2-sulfanylidene-1,3-thiazolidin-4-one;molecular hydrogen.
| Compound Name | (5Z)-3-(1,3-benzodioxol-5-ylmethyl)-5-[2-(1H-indol-3-yl)ethylidene]-2-sulfanylidene-1,3-thiazolidin-4-one;molecular hydrogen |
|---|---|
| PubChem CID | 143654880 |
| Molecular Formula | C21H18N2O3S2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | (5Z)-3-(1,3-benzodioxol-5-ylmethyl)-5-[2-(1H-indol-3-yl)ethylidene]-2-sulfanylidene-1,3-thiazolidin-4-one;molecular hydrogen |
| SMILES | O=C1/C(=C/Cc2c[nH]c3ccccc23)SC(=S)N1Cc1ccc2c(c1)OCO2.[H][H] |
| InChI | InChI=1S/C21H16N2O3S2.H2/c24-20-19(8-6-14-10-22-16-4-2-1-3-15(14)16)28-21(27)23(20)11-13-5-7-17-18(9-13)26-12-25-17;/h1-5,7-10,22H,6,11-12H2;1H/b19-8-; |
| InChIKey | DCUSFNYSKPGWIA-SRJUEMFDSA-N |
| XLogP | 4.63 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|