C25H27NO5S — CID 143656056
(3'R,5'S,6S,6'R)-4-[(4-ethylphenyl)methyl]-6'-(hydroxymethyl)spiro[8H-furo[3,4-g]quinoline-6,2'-thiane]-3',4',5'-triol (PubChem CID 143656056) has the molecular formula C25H27NO5S and a molecular weight of 453.56 g/mol. Its IUPAC name is (3'R,5'S,6S,6'R)-4-[(4-ethylphenyl)methyl]-6'-(hydroxymethyl)spiro[8H-furo[3,4-g]quinoline-6,2'-thiane]-3',4',5'-triol.
| Compound Name | (3'R,5'S,6S,6'R)-4-[(4-ethylphenyl)methyl]-6'-(hydroxymethyl)spiro[8H-furo[3,4-g]quinoline-6,2'-thiane]-3',4',5'-triol |
|---|---|
| PubChem CID | 143656056 |
| Molecular Formula | C25H27NO5S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | (3'R,5'S,6S,6'R)-4-[(4-ethylphenyl)methyl]-6'-(hydroxymethyl)spiro[8H-furo[3,4-g]quinoline-6,2'-thiane]-3',4',5'-triol |
| SMILES | CCc1ccc(Cc2ccnc3cc4c(cc23)[C@]2(OC4)S[C@H](CO)[C@@H](O)C(O)[C@H]2O)cc1 |
| InChI | InChI=1S/C25H27NO5S/c1-2-14-3-5-15(6-4-14)9-16-7-8-26-20-10-17-13-31-25(19(17)11-18(16)20)24(30)23(29)22(28)21(12-27)32-25/h3-8,10-11,21-24,27-30H,2,9,12-13H2,1H3/t21-,22-,23?,24-,25+/m1/s1 |
| InChIKey | WFEUFCRSEJWBJK-ZJNKMKHDSA-N |
| XLogP | 2.26 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |