About ethane;3-methyl-7-methylsulfanylpyrazolo[1,5-a]pyrimidine
ethane;3-methyl-7-methylsulfanylpyrazolo[1,5-a]pyrimidine (PubChem CID 143656235) has the molecular formula C10H15N3S
and a molecular weight of 209.32 g/mol. Its IUPAC name is ethane;3-methyl-7-methylsulfanylpyrazolo[1,5-a]pyrimidine.
Molecular Properties
| Compound Name | ethane;3-methyl-7-methylsulfanylpyrazolo[1,5-a]pyrimidine |
| PubChem CID | 143656235 |
| Molecular Formula | C10H15N3S |
| Molecular Weight | 209.32 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | ethane;3-methyl-7-methylsulfanylpyrazolo[1,5-a]pyrimidine |
| SMILES | CC.CSc1ccnc2c(C)cnn12 |
| InChI | InChI=1S/C8H9N3S.C2H6/c1-6-5-10-11-7(12-2)3-4-9-8(6)11;1-2/h3-5H,1-2H3;1-2H3 |
| InChIKey | GPDGHYBFYOKKAB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;3-methyl-7-methylsulfanylpyrazolo[1,5-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methyl-7-methylsulfanylpyrazolo[1,5-a]pyrimidine?
The IUPAC name of ethane;3-methyl-7-methylsulfanylpyrazolo[1,5-a]pyrimidine (CID 143656235) is ethane;3-methyl-7-methylsulfanylpyrazolo[1,5-a]pyrimidine.
What is the SMILES notation for ethane;3-methyl-7-methylsulfanylpyrazolo[1,5-a]pyrimidine?
The canonical SMILES for ethane;3-methyl-7-methylsulfanylpyrazolo[1,5-a]pyrimidine is CC.CSc1ccnc2c(C)cnn12.
What is the InChIKey of ethane;3-methyl-7-methylsulfanylpyrazolo[1,5-a]pyrimidine?
The InChIKey is GPDGHYBFYOKKAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3S.C2H6/c1-6-5-10-11-7(12-2)3-4-9-8(6)11;1-2/h3-5H,1-2H3;1-2H3.
What are the key properties of ethane;3-methyl-7-methylsulfanylpyrazolo[1,5-a]pyrimidine?
ethane;3-methyl-7-methylsulfanylpyrazolo[1,5-a]pyrimidine has a molecular weight of 209.32 g/mol, XLogP of 2.79, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methyl-7-methylsulfanylpyrazolo[1,5-a]pyrimidine is sourced from PubChem (CID 143656235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).