About 2,2-difluoro-5,5a-dihydro-4aH-cyclopropa[f][1,3]benzodioxole
2,2-difluoro-5,5a-dihydro-4aH-cyclopropa[f][1,3]benzodioxole (PubChem CID 143656494) has the molecular formula C8H6F2O2
and a molecular weight of 172.13 g/mol. Its IUPAC name is 2,2-difluoro-5,5a-dihydro-4aH-cyclopropa[f][1,3]benzodioxole.
Molecular Properties
| Compound Name | 2,2-difluoro-5,5a-dihydro-4aH-cyclopropa[f][1,3]benzodioxole |
| PubChem CID | 143656494 |
| Molecular Formula | C8H6F2O2 |
| Molecular Weight | 172.13 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | 2,2-difluoro-5,5a-dihydro-4aH-cyclopropa[f][1,3]benzodioxole |
| SMILES | FC1(F)OC2=CC3CC3C=C2O1 |
| InChI | InChI=1S/C8H6F2O2/c9-8(10)11-6-2-4-1-5(4)3-7(6)12-8/h2-5H,1H2 |
| InChIKey | AGPYOZIXDLUWGY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.13 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-difluoro-5,5a-dihydro-4aH-cyclopropa[f][1,3]benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-5,5a-dihydro-4aH-cyclopropa[f][1,3]benzodioxole?
The IUPAC name of 2,2-difluoro-5,5a-dihydro-4aH-cyclopropa[f][1,3]benzodioxole (CID 143656494) is 2,2-difluoro-5,5a-dihydro-4aH-cyclopropa[f][1,3]benzodioxole.
What is the SMILES notation for 2,2-difluoro-5,5a-dihydro-4aH-cyclopropa[f][1,3]benzodioxole?
The canonical SMILES for 2,2-difluoro-5,5a-dihydro-4aH-cyclopropa[f][1,3]benzodioxole is FC1(F)OC2=CC3CC3C=C2O1.
What is the InChIKey of 2,2-difluoro-5,5a-dihydro-4aH-cyclopropa[f][1,3]benzodioxole?
The InChIKey is AGPYOZIXDLUWGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6F2O2/c9-8(10)11-6-2-4-1-5(4)3-7(6)12-8/h2-5H,1H2.
What are the key properties of 2,2-difluoro-5,5a-dihydro-4aH-cyclopropa[f][1,3]benzodioxole?
2,2-difluoro-5,5a-dihydro-4aH-cyclopropa[f][1,3]benzodioxole has a molecular weight of 172.13 g/mol, XLogP of 2.00, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-5,5a-dihydro-4aH-cyclopropa[f][1,3]benzodioxole is sourced from PubChem (CID 143656494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).