C26H35N3O6S — CID 143656747
2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-N-hydroxy-3-[4-(4-methylphenoxy)-N-methylsulfonylanilino]-N-prop-2-enylpropanamide (PubChem CID 143656747) has the molecular formula C26H35N3O6S and a molecular weight of 517.65 g/mol. Its IUPAC name is 2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-N-hydroxy-3-[4-(4-methylphenoxy)-N-methylsulfonylanilino]-N-prop-2-enylpropanamide.
| Compound Name | 2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-N-hydroxy-3-[4-(4-methylphenoxy)-N-methylsulfonylanilino]-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 143656747 |
| Molecular Formula | C26H35N3O6S |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | 2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-N-hydroxy-3-[4-(4-methylphenoxy)-N-methylsulfonylanilino]-N-prop-2-enylpropanamide |
| SMILES | C=CCN(O)C(=O)C(CN(c1ccc(Oc2ccc(C)cc2)cc1)S(C)(=O)=O)N1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C26H35N3O6S/c1-6-15-28(31)26(30)25(27-16-20(3)34-21(4)17-27)18-29(36(5,32)33)22-9-13-24(14-10-22)35-23-11-7-19(2)8-12-23/h6-14,20-21,25,31H,1,15-18H2,2-5H3/t20-,21+,25? |
| InChIKey | ZWPRCEQHXZCMFK-KEVCNVLYSA-N |
| XLogP | 3.43 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|