C6H7Cl2N — CID 143657118
(2E,4E)-3,5-dichloro-N-methylpenta-2,4-dien-1-imine (PubChem CID 143657118) has the molecular formula C6H7Cl2N and a molecular weight of 164.03 g/mol. Its IUPAC name is (2E,4E)-3,5-dichloro-N-methylpenta-2,4-dien-1-imine.
| Compound Name | (2E,4E)-3,5-dichloro-N-methylpenta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 143657118 |
| Molecular Formula | C6H7Cl2N |
| Molecular Weight | 164.03 g/mol |
| Exact Mass | 163.00 |
| IUPAC Name | (2E,4E)-3,5-dichloro-N-methylpenta-2,4-dien-1-imine |
| SMILES | C/N=C/C=C(Cl)\C=C\Cl |
| InChI | InChI=1S/C6H7Cl2N/c1-9-5-3-6(8)2-4-7/h2-5H,1H3/b4-2+,6-3+,9-5+ |
| InChIKey | OIZWSUBWFWVJDU-CSLJHPTESA-N |
| XLogP | 2.56 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.03 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|